C24H15N3O7S2 — CID 3875274
N-(2-methyl-5-nitrophenyl)sulfonyl-N-(2-oxobenzo[g][1,3]benzoxathiol-5-yl)pyridine-3-carboxamide (PubChem CID 3875274) has the molecular formula C24H15N3O7S2 and a molecular weight of 521.53 g/mol. Its IUPAC name is N-(2-methyl-5-nitrophenyl)sulfonyl-N-(2-oxobenzo[g][1,3]benzoxathiol-5-yl)pyridine-3-carboxamide.
| Compound Name | N-(2-methyl-5-nitrophenyl)sulfonyl-N-(2-oxobenzo[g][1,3]benzoxathiol-5-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 3875274 |
| Molecular Formula | C24H15N3O7S2 |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.04 |
| IUPAC Name | N-(2-methyl-5-nitrophenyl)sulfonyl-N-(2-oxobenzo[g][1,3]benzoxathiol-5-yl)pyridine-3-carboxamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)N(C(=O)c1cccnc1)c1cc2sc(=O)oc2c2ccccc12 |
| InChI | InChI=1S/C24H15N3O7S2/c1-14-8-9-16(27(30)31)11-21(14)36(32,33)26(23(28)15-5-4-10-25-13-15)19-12-20-22(34-24(29)35-20)18-7-3-2-6-17(18)19/h2-13H,1H3 |
| InChIKey | MMSJVBARHJVHPI-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 140.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|