C12H7Br2NO — CID 112694374
(2,5-dibromophenyl)-pyridin-3-ylmethanone (PubChem CID 112694374) has the molecular formula C12H7Br2NO and a molecular weight of 341.00 g/mol. Its IUPAC name is (2,5-dibromophenyl)-pyridin-3-ylmethanone.
| Compound Name | (2,5-dibromophenyl)-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 112694374 |
| Molecular Formula | C12H7Br2NO |
| Molecular Weight | 341.00 g/mol |
| Exact Mass | 338.89 |
| IUPAC Name | (2,5-dibromophenyl)-pyridin-3-ylmethanone |
| SMILES | O=C(c1cccnc1)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C12H7Br2NO/c13-9-3-4-11(14)10(6-9)12(16)8-2-1-5-15-7-8/h1-7H |
| InChIKey | PAZDPPWXBMKLRA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.00 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |