C17H16Br2O — CID 115812427
(2,5-dibromophenyl)-[3-(2-methylpropyl)phenyl]methanone (PubChem CID 115812427) has the molecular formula C17H16Br2O and a molecular weight of 396.12 g/mol. Its IUPAC name is (2,5-dibromophenyl)-[3-(2-methylpropyl)phenyl]methanone.
| Compound Name | (2,5-dibromophenyl)-[3-(2-methylpropyl)phenyl]methanone |
|---|---|
| PubChem CID | 115812427 |
| Molecular Formula | C17H16Br2O |
| Molecular Weight | 396.12 g/mol |
| Exact Mass | 393.96 |
| IUPAC Name | (2,5-dibromophenyl)-[3-(2-methylpropyl)phenyl]methanone |
| SMILES | CC(C)Cc1cccc(C(=O)c2cc(Br)ccc2Br)c1 |
| InChI | InChI=1S/C17H16Br2O/c1-11(2)8-12-4-3-5-13(9-12)17(20)15-10-14(18)6-7-16(15)19/h3-7,9-11H,8H2,1-2H3 |
| InChIKey | DWIVQYJHCISUKJ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.12 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |