C17H15F3O — CID 115812361
[3-(2-methylpropyl)phenyl]-(2,3,4-trifluorophenyl)methanone (PubChem CID 115812361) has the molecular formula C17H15F3O and a molecular weight of 292.30 g/mol. Its IUPAC name is [3-(2-methylpropyl)phenyl]-(2,3,4-trifluorophenyl)methanone.
| Compound Name | [3-(2-methylpropyl)phenyl]-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 115812361 |
| Molecular Formula | C17H15F3O |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | [3-(2-methylpropyl)phenyl]-(2,3,4-trifluorophenyl)methanone |
| SMILES | CC(C)Cc1cccc(C(=O)c2ccc(F)c(F)c2F)c1 |
| InChI | InChI=1S/C17H15F3O/c1-10(2)8-11-4-3-5-12(9-11)17(21)13-6-7-14(18)16(20)15(13)19/h3-7,9-10H,8H2,1-2H3 |
| InChIKey | PPEAUBBPMVFFAM-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|