C20H11ClN2O7S2 — CID 18560654
N-(4-chlorophenyl)sulfonyl-4-nitro-N-(2-oxo-1,3-benzoxathiol-5-yl)benzamide (PubChem CID 18560654) has the molecular formula C20H11ClN2O7S2 and a molecular weight of 490.90 g/mol. Its IUPAC name is N-(4-chlorophenyl)sulfonyl-4-nitro-N-(2-oxo-1,3-benzoxathiol-5-yl)benzamide.
| Compound Name | N-(4-chlorophenyl)sulfonyl-4-nitro-N-(2-oxo-1,3-benzoxathiol-5-yl)benzamide |
|---|---|
| PubChem CID | 18560654 |
| Molecular Formula | C20H11ClN2O7S2 |
| Molecular Weight | 490.90 g/mol |
| Exact Mass | 489.97 |
| IUPAC Name | N-(4-chlorophenyl)sulfonyl-4-nitro-N-(2-oxo-1,3-benzoxathiol-5-yl)benzamide |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)N(c1ccc2oc(=O)sc2c1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H11ClN2O7S2/c21-13-3-8-16(9-4-13)32(28,29)22(15-7-10-17-18(11-15)31-20(25)30-17)19(24)12-1-5-14(6-2-12)23(26)27/h1-11H |
| InChIKey | VYCUGLQWXSZIRJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 127.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.90 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|