C28H26N2O6S — CID 23829125
4-nitro-N-(6,7,8,9-tetrahydrodibenzofuran-2-yl)-N-(2,4,5-trimethylphenyl)sulfonylbenzamide (PubChem CID 23829125) has the molecular formula C28H26N2O6S and a molecular weight of 518.59 g/mol. Its IUPAC name is 4-nitro-N-(6,7,8,9-tetrahydrodibenzofuran-2-yl)-N-(2,4,5-trimethylphenyl)sulfonylbenzamide.
| Compound Name | 4-nitro-N-(6,7,8,9-tetrahydrodibenzofuran-2-yl)-N-(2,4,5-trimethylphenyl)sulfonylbenzamide |
|---|---|
| PubChem CID | 23829125 |
| Molecular Formula | C28H26N2O6S |
| Molecular Weight | 518.59 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | 4-nitro-N-(6,7,8,9-tetrahydrodibenzofuran-2-yl)-N-(2,4,5-trimethylphenyl)sulfonylbenzamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N(C(=O)c2ccc([N+](=O)[O-])cc2)c2ccc3oc4c(c3c2)CCCC4)cc1C |
| InChI | InChI=1S/C28H26N2O6S/c1-17-14-19(3)27(15-18(17)2)37(34,35)29(28(31)20-8-10-21(11-9-20)30(32)33)22-12-13-26-24(16-22)23-6-4-5-7-25(23)36-26/h8-16H,4-7H2,1-3H3 |
| InChIKey | POSRLOOCPAJPAX-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 110.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.59 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|