C25H19ClN2O6S — CID 23746358
N-(4-chlorophenyl)sulfonyl-4-nitro-N-(6,7,8,9-tetrahydrodibenzofuran-2-yl)benzamide (PubChem CID 23746358) has the molecular formula C25H19ClN2O6S and a molecular weight of 510.96 g/mol. Its IUPAC name is N-(4-chlorophenyl)sulfonyl-4-nitro-N-(6,7,8,9-tetrahydrodibenzofuran-2-yl)benzamide.
| Compound Name | N-(4-chlorophenyl)sulfonyl-4-nitro-N-(6,7,8,9-tetrahydrodibenzofuran-2-yl)benzamide |
|---|---|
| PubChem CID | 23746358 |
| Molecular Formula | C25H19ClN2O6S |
| Molecular Weight | 510.96 g/mol |
| Exact Mass | 510.07 |
| IUPAC Name | N-(4-chlorophenyl)sulfonyl-4-nitro-N-(6,7,8,9-tetrahydrodibenzofuran-2-yl)benzamide |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)N(c1ccc2oc3c(c2c1)CCCC3)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H19ClN2O6S/c26-17-7-12-20(13-8-17)35(32,33)27(25(29)16-5-9-18(10-6-16)28(30)31)19-11-14-24-22(15-19)21-3-1-2-4-23(21)34-24/h5-15H,1-4H2 |
| InChIKey | QYIUZGNEYBCTCK-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 110.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.96 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|