C18H17NO5S2 — CID 7013998
N-(2-oxo-1,3-benzoxathiol-5-yl)-N-(2,4,6-trimethylphenyl)sulfonylacetamide (PubChem CID 7013998) has the molecular formula C18H17NO5S2 and a molecular weight of 391.47 g/mol. Its IUPAC name is N-(2-oxo-1,3-benzoxathiol-5-yl)-N-(2,4,6-trimethylphenyl)sulfonylacetamide.
| Compound Name | N-(2-oxo-1,3-benzoxathiol-5-yl)-N-(2,4,6-trimethylphenyl)sulfonylacetamide |
|---|---|
| PubChem CID | 7013998 |
| Molecular Formula | C18H17NO5S2 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | N-(2-oxo-1,3-benzoxathiol-5-yl)-N-(2,4,6-trimethylphenyl)sulfonylacetamide |
| SMILES | CC(=O)N(c1ccc2oc(=O)sc2c1)S(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C18H17NO5S2/c1-10-7-11(2)17(12(3)8-10)26(22,23)19(13(4)20)14-5-6-15-16(9-14)25-18(21)24-15/h5-9H,1-4H3 |
| InChIKey | NFDNXEVSMVROPX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 84.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'} |
|---|