C26H19NO7S2 — CID 5051201
4-methoxy-N-(4-methoxyphenyl)sulfonyl-N-(2-oxobenzo[g][1,3]benzoxathiol-5-yl)benzamide (PubChem CID 5051201) has the molecular formula C26H19NO7S2 and a molecular weight of 521.57 g/mol. Its IUPAC name is 4-methoxy-N-(4-methoxyphenyl)sulfonyl-N-(2-oxobenzo[g][1,3]benzoxathiol-5-yl)benzamide.
| Compound Name | 4-methoxy-N-(4-methoxyphenyl)sulfonyl-N-(2-oxobenzo[g][1,3]benzoxathiol-5-yl)benzamide |
|---|---|
| PubChem CID | 5051201 |
| Molecular Formula | C26H19NO7S2 |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.06 |
| IUPAC Name | 4-methoxy-N-(4-methoxyphenyl)sulfonyl-N-(2-oxobenzo[g][1,3]benzoxathiol-5-yl)benzamide |
| SMILES | COc1ccc(C(=O)N(c2cc3sc(=O)oc3c3ccccc23)S(=O)(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H19NO7S2/c1-32-17-9-7-16(8-10-17)25(28)27(36(30,31)19-13-11-18(33-2)12-14-19)22-15-23-24(34-26(29)35-23)21-6-4-3-5-20(21)22/h3-15H,1-2H3 |
| InChIKey | YXGTZSCVPFRLDY-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'} |
|---|