C25H16FNO6S2 — CID 3650956
phenyl N-(4-fluoro-2-methylphenyl)sulfonyl-N-(2-oxobenzo[g][1,3]benzoxathiol-5-yl)carbamate (PubChem CID 3650956) has the molecular formula C25H16FNO6S2 and a molecular weight of 509.54 g/mol. Its IUPAC name is phenyl N-(4-fluoro-2-methylphenyl)sulfonyl-N-(2-oxobenzo[g][1,3]benzoxathiol-5-yl)carbamate.
| Compound Name | phenyl N-(4-fluoro-2-methylphenyl)sulfonyl-N-(2-oxobenzo[g][1,3]benzoxathiol-5-yl)carbamate |
|---|---|
| PubChem CID | 3650956 |
| Molecular Formula | C25H16FNO6S2 |
| Molecular Weight | 509.54 g/mol |
| Exact Mass | 509.04 |
| IUPAC Name | phenyl N-(4-fluoro-2-methylphenyl)sulfonyl-N-(2-oxobenzo[g][1,3]benzoxathiol-5-yl)carbamate |
| SMILES | Cc1cc(F)ccc1S(=O)(=O)N(C(=O)Oc1ccccc1)c1cc2sc(=O)oc2c2ccccc12 |
| InChI | InChI=1S/C25H16FNO6S2/c1-15-13-16(26)11-12-22(15)35(30,31)27(24(28)32-17-7-3-2-4-8-17)20-14-21-23(33-25(29)34-21)19-10-6-5-9-18(19)20/h2-14H,1H3 |
| InChIKey | ZBIXRIYGSSESAS-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.54 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'} |
|---|