C24H21NO5S2 — CID 22332150
N-(benzenesulfonyl)-N-(2-oxobenzo[g][1,3]benzoxathiol-5-yl)cyclohexanecarboxamide (PubChem CID 22332150) has the molecular formula C24H21NO5S2 and a molecular weight of 467.57 g/mol. Its IUPAC name is N-(benzenesulfonyl)-N-(2-oxobenzo[g][1,3]benzoxathiol-5-yl)cyclohexanecarboxamide.
| Compound Name | N-(benzenesulfonyl)-N-(2-oxobenzo[g][1,3]benzoxathiol-5-yl)cyclohexanecarboxamide |
|---|---|
| PubChem CID | 22332150 |
| Molecular Formula | C24H21NO5S2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | N-(benzenesulfonyl)-N-(2-oxobenzo[g][1,3]benzoxathiol-5-yl)cyclohexanecarboxamide |
| SMILES | O=C(C1CCCCC1)N(c1cc2sc(=O)oc2c2ccccc12)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H21NO5S2/c26-23(16-9-3-1-4-10-16)25(32(28,29)17-11-5-2-6-12-17)20-15-21-22(30-24(27)31-21)19-14-8-7-13-18(19)20/h2,5-8,11-16H,1,3-4,9-10H2 |
| InChIKey | PGMDYGGBNGVBKR-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 84.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'} |
|---|