C14H19NO2S — CID 122208403
N-(methyl-oxo-phenyl-λ6-sulfanylidene)cyclohexanecarboxamide (PubChem CID 122208403) has the molecular formula C14H19NO2S and a molecular weight of 265.38 g/mol. Its IUPAC name is N-(methyl-oxo-phenyl-λ6-sulfanylidene)cyclohexanecarboxamide.
| Compound Name | N-(methyl-oxo-phenyl-λ6-sulfanylidene)cyclohexanecarboxamide |
|---|---|
| PubChem CID | 122208403 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | N-(methyl-oxo-phenyl-λ6-sulfanylidene)cyclohexanecarboxamide |
| SMILES | CS(=O)(=NC(=O)C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C14H19NO2S/c1-18(17,13-10-6-3-7-11-13)15-14(16)12-8-4-2-5-9-12/h3,6-7,10-12H,2,4-5,8-9H2,1H3 |
| InChIKey | CWKJHSSELSSRAT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |