C20H15F2NO4S — CID 126615373
N-(2,4-difluorophenyl)sulfonyl-N-(4-methoxyphenyl)benzamide (PubChem CID 126615373) has the molecular formula C20H15F2NO4S and a molecular weight of 403.41 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)sulfonyl-N-(4-methoxyphenyl)benzamide.
| Compound Name | N-(2,4-difluorophenyl)sulfonyl-N-(4-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 126615373 |
| Molecular Formula | C20H15F2NO4S |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | N-(2,4-difluorophenyl)sulfonyl-N-(4-methoxyphenyl)benzamide |
| SMILES | COc1ccc(N(C(=O)c2ccccc2)S(=O)(=O)c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C20H15F2NO4S/c1-27-17-10-8-16(9-11-17)23(20(24)14-5-3-2-4-6-14)28(25,26)19-12-7-15(21)13-18(19)22/h2-13H,1H3 |
| InChIKey | ZJIRSOPKOBQVFO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |