C11H11NO5S — CID 71331178
(7-methoxy-2-oxo-1,3-benzoxathiol-5-yl) N,N-dimethylcarbamate (PubChem CID 71331178) has the molecular formula C11H11NO5S and a molecular weight of 269.28 g/mol. Its IUPAC name is (7-methoxy-2-oxo-1,3-benzoxathiol-5-yl) N,N-dimethylcarbamate.
| Compound Name | (7-methoxy-2-oxo-1,3-benzoxathiol-5-yl) N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 71331178 |
| Molecular Formula | C11H11NO5S |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | (7-methoxy-2-oxo-1,3-benzoxathiol-5-yl) N,N-dimethylcarbamate |
| SMILES | COc1cc(OC(=O)N(C)C)cc2sc(=O)oc12 |
| InChI | InChI=1S/C11H11NO5S/c1-12(2)10(13)16-6-4-7(15-3)9-8(5-6)18-11(14)17-9/h4-5H,1-3H3 |
| InChIKey | IQMQFALAHLUGNS-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'}, {'alert_name': 'thio_carbonate_B(3)', 'substructure': 'N/A'} |
|---|