C11H8N2O4S — CID 117414699
5-(5-amino-1,2-oxazol-3-yl)-7-methoxy-1,3-benzoxathiol-2-one (PubChem CID 117414699) has the molecular formula C11H8N2O4S and a molecular weight of 264.26 g/mol. Its IUPAC name is 5-(5-amino-1,2-oxazol-3-yl)-7-methoxy-1,3-benzoxathiol-2-one.
| Compound Name | 5-(5-amino-1,2-oxazol-3-yl)-7-methoxy-1,3-benzoxathiol-2-one |
|---|---|
| PubChem CID | 117414699 |
| Molecular Formula | C11H8N2O4S |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 5-(5-amino-1,2-oxazol-3-yl)-7-methoxy-1,3-benzoxathiol-2-one |
| SMILES | COc1cc(-c2cc(N)on2)cc2sc(=O)oc12 |
| InChI | InChI=1S/C11H8N2O4S/c1-15-7-2-5(6-4-9(12)17-13-6)3-8-10(7)16-11(14)18-8/h2-4H,12H2,1H3 |
| InChIKey | OJDYJUDZNWQBNN-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_carbonate_B(3)', 'substructure': 'N/A'} |
|---|