C11H10N2O5 — CID 136998086
5-(5-amino-1,2-oxazol-3-yl)-2-hydroxy-3-methoxybenzoic acid (PubChem CID 136998086) has the molecular formula C11H10N2O5 and a molecular weight of 250.21 g/mol. Its IUPAC name is 5-(5-amino-1,2-oxazol-3-yl)-2-hydroxy-3-methoxybenzoic acid.
| Compound Name | 5-(5-amino-1,2-oxazol-3-yl)-2-hydroxy-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 136998086 |
| Molecular Formula | C11H10N2O5 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 5-(5-amino-1,2-oxazol-3-yl)-2-hydroxy-3-methoxybenzoic acid |
| SMILES | COc1cc(-c2cc(N)on2)cc(C(=O)O)c1O |
| InChI | InChI=1S/C11H10N2O5/c1-17-8-3-5(7-4-9(12)18-13-7)2-6(10(8)14)11(15)16/h2-4,14H,12H2,1H3,(H,15,16) |
| InChIKey | UIHXTSZBVFZTNG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |