C12H12N2O5 — CID 117414574
3-(5-amino-1,2-oxazol-3-yl)-4,5-dimethoxybenzoic acid (PubChem CID 117414574) has the molecular formula C12H12N2O5 and a molecular weight of 264.24 g/mol. Its IUPAC name is 3-(5-amino-1,2-oxazol-3-yl)-4,5-dimethoxybenzoic acid.
| Compound Name | 3-(5-amino-1,2-oxazol-3-yl)-4,5-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 117414574 |
| Molecular Formula | C12H12N2O5 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 3-(5-amino-1,2-oxazol-3-yl)-4,5-dimethoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)cc(-c2cc(N)on2)c1OC |
| InChI | InChI=1S/C12H12N2O5/c1-17-9-4-6(12(15)16)3-7(11(9)18-2)8-5-10(13)19-14-8/h3-5H,13H2,1-2H3,(H,15,16) |
| InChIKey | RNZLRQMDWATBDX-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |