C13H15ClN2O3 — CID 117454226
3-(3-chloro-2-ethyl-4,5-dimethoxyphenyl)-1,2-oxazol-5-amine (PubChem CID 117454226) has the molecular formula C13H15ClN2O3 and a molecular weight of 282.73 g/mol. Its IUPAC name is 3-(3-chloro-2-ethyl-4,5-dimethoxyphenyl)-1,2-oxazol-5-amine.
| Compound Name | 3-(3-chloro-2-ethyl-4,5-dimethoxyphenyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117454226 |
| Molecular Formula | C13H15ClN2O3 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 3-(3-chloro-2-ethyl-4,5-dimethoxyphenyl)-1,2-oxazol-5-amine |
| SMILES | CCc1c(-c2cc(N)on2)cc(OC)c(OC)c1Cl |
| InChI | InChI=1S/C13H15ClN2O3/c1-4-7-8(9-6-11(15)19-16-9)5-10(17-2)13(18-3)12(7)14/h5-6H,4,15H2,1-3H3 |
| InChIKey | BOTJHFJUOQEMMZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |