C11H10O5S — CID 117388673
2-(5-methoxy-2-oxo-1,3-benzoxathiol-6-yl)propanoic acid (PubChem CID 117388673) has the molecular formula C11H10O5S and a molecular weight of 254.26 g/mol. Its IUPAC name is 2-(5-methoxy-2-oxo-1,3-benzoxathiol-6-yl)propanoic acid.
| Compound Name | 2-(5-methoxy-2-oxo-1,3-benzoxathiol-6-yl)propanoic acid |
|---|---|
| PubChem CID | 117388673 |
| Molecular Formula | C11H10O5S |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | 2-(5-methoxy-2-oxo-1,3-benzoxathiol-6-yl)propanoic acid |
| SMILES | COc1cc2sc(=O)oc2cc1C(C)C(=O)O |
| InChI | InChI=1S/C11H10O5S/c1-5(10(12)13)6-3-8-9(4-7(6)15-2)17-11(14)16-8/h3-5H,1-2H3,(H,12,13) |
| InChIKey | NDUNOJQKVRVUHD-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'} |
|---|