C13H14O5S — CID 117453554
3-(5-methoxy-2-oxo-1,3-benzoxathiol-6-yl)-2,2-dimethylpropanoic acid (PubChem CID 117453554) has the molecular formula C13H14O5S and a molecular weight of 282.32 g/mol. Its IUPAC name is 3-(5-methoxy-2-oxo-1,3-benzoxathiol-6-yl)-2,2-dimethylpropanoic acid.
| Compound Name | 3-(5-methoxy-2-oxo-1,3-benzoxathiol-6-yl)-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 117453554 |
| Molecular Formula | C13H14O5S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 3-(5-methoxy-2-oxo-1,3-benzoxathiol-6-yl)-2,2-dimethylpropanoic acid |
| SMILES | COc1cc2sc(=O)oc2cc1CC(C)(C)C(=O)O |
| InChI | InChI=1S/C13H14O5S/c1-13(2,11(14)15)6-7-4-9-10(5-8(7)17-3)19-12(16)18-9/h4-5H,6H2,1-3H3,(H,14,15) |
| InChIKey | YCWRKZKKIROKBR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'} |
|---|