About 3-(5-methoxy-2-oxo-1,3-benzoxathiol-6-yl)-2,2-dimethylpropanoic acid
3-(5-methoxy-2-oxo-1,3-benzoxathiol-6-yl)-2,2-dimethylpropanoic acid (PubChem CID 117453554) has the molecular formula C13H14O5S
and a molecular weight of 282.32 g/mol. Its IUPAC name is 3-(5-methoxy-2-oxo-1,3-benzoxathiol-6-yl)-2,2-dimethylpropanoic acid.
Molecular Properties
| Compound Name | 3-(5-methoxy-2-oxo-1,3-benzoxathiol-6-yl)-2,2-dimethylpropanoic acid |
| PubChem CID | 117453554 |
| Molecular Formula | C13H14O5S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 3-(5-methoxy-2-oxo-1,3-benzoxathiol-6-yl)-2,2-dimethylpropanoic acid |
| SMILES | COc1cc2sc(=O)oc2cc1CC(C)(C)C(=O)O |
| InChI | InChI=1S/C13H14O5S/c1-13(2,11(14)15)6-7-4-9-10(5-8(7)17-3)19-12(16)18-9/h4-5H,6H2,1-3H3,(H,14,15) |
| InChIKey | YCWRKZKKIROKBR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-methoxy-2-oxo-1,3-benzoxathiol-6-yl)-2,2-dimethylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-methoxy-2-oxo-1,3-benzoxathiol-6-yl)-2,2-dimethylpropanoic acid?
The IUPAC name of 3-(5-methoxy-2-oxo-1,3-benzoxathiol-6-yl)-2,2-dimethylpropanoic acid (CID 117453554) is 3-(5-methoxy-2-oxo-1,3-benzoxathiol-6-yl)-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-(5-methoxy-2-oxo-1,3-benzoxathiol-6-yl)-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-(5-methoxy-2-oxo-1,3-benzoxathiol-6-yl)-2,2-dimethylpropanoic acid is COc1cc2sc(=O)oc2cc1CC(C)(C)C(=O)O.
What is the InChIKey of 3-(5-methoxy-2-oxo-1,3-benzoxathiol-6-yl)-2,2-dimethylpropanoic acid?
The InChIKey is YCWRKZKKIROKBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O5S/c1-13(2,11(14)15)6-7-4-9-10(5-8(7)17-3)19-12(16)18-9/h4-5H,6H2,1-3H3,(H,14,15).
What are the key properties of 3-(5-methoxy-2-oxo-1,3-benzoxathiol-6-yl)-2,2-dimethylpropanoic acid?
3-(5-methoxy-2-oxo-1,3-benzoxathiol-6-yl)-2,2-dimethylpropanoic acid has a molecular weight of 282.32 g/mol, XLogP of 2.52, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-methoxy-2-oxo-1,3-benzoxathiol-6-yl)-2,2-dimethylpropanoic acid is sourced from PubChem (CID 117453554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).