C11H12O4S — CID 117353194
6-(2-hydroxypropyl)-5-methoxy-1,3-benzoxathiol-2-one (PubChem CID 117353194) has the molecular formula C11H12O4S and a molecular weight of 240.28 g/mol. Its IUPAC name is 6-(2-hydroxypropyl)-5-methoxy-1,3-benzoxathiol-2-one.
| Compound Name | 6-(2-hydroxypropyl)-5-methoxy-1,3-benzoxathiol-2-one |
|---|---|
| PubChem CID | 117353194 |
| Molecular Formula | C11H12O4S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 6-(2-hydroxypropyl)-5-methoxy-1,3-benzoxathiol-2-one |
| SMILES | COc1cc2sc(=O)oc2cc1CC(C)O |
| InChI | InChI=1S/C11H12O4S/c1-6(12)3-7-4-9-10(5-8(7)14-2)16-11(13)15-9/h4-6,12H,3H2,1-2H3 |
| InChIKey | FCNVBDXYLWPGIT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'} |
|---|