C11H16O4 — CID 117303005
5-(2-hydroxypropyl)-2,4-dimethoxyphenol (PubChem CID 117303005) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is 5-(2-hydroxypropyl)-2,4-dimethoxyphenol.
| Compound Name | 5-(2-hydroxypropyl)-2,4-dimethoxyphenol |
|---|---|
| PubChem CID | 117303005 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 5-(2-hydroxypropyl)-2,4-dimethoxyphenol |
| SMILES | COc1cc(OC)c(CC(C)O)cc1O |
| InChI | InChI=1S/C11H16O4/c1-7(12)4-8-5-9(13)11(15-3)6-10(8)14-2/h5-7,12-13H,4H2,1-3H3 |
| InChIKey | IBGYJKLQQJLUPF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |