C12H17FO3 — CID 117328887
1-[4-(fluoromethyl)-2,5-dimethoxyphenyl]propan-2-ol (PubChem CID 117328887) has the molecular formula C12H17FO3 and a molecular weight of 228.26 g/mol. Its IUPAC name is 1-[4-(fluoromethyl)-2,5-dimethoxyphenyl]propan-2-ol.
| Compound Name | 1-[4-(fluoromethyl)-2,5-dimethoxyphenyl]propan-2-ol |
|---|---|
| PubChem CID | 117328887 |
| Molecular Formula | C12H17FO3 |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 1-[4-(fluoromethyl)-2,5-dimethoxyphenyl]propan-2-ol |
| SMILES | COc1cc(CC(C)O)c(OC)cc1CF |
| InChI | InChI=1S/C12H17FO3/c1-8(14)4-9-5-12(16-3)10(7-13)6-11(9)15-2/h5-6,8,14H,4,7H2,1-3H3 |
| InChIKey | DCCWAHOHEXEAKG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |