C11H10O6S — CID 117428716
ethyl 2-hydroxy-2-(5-hydroxy-2-oxo-1,3-benzoxathiol-6-yl)acetate (PubChem CID 117428716) has the molecular formula C11H10O6S and a molecular weight of 270.26 g/mol. Its IUPAC name is ethyl 2-hydroxy-2-(5-hydroxy-2-oxo-1,3-benzoxathiol-6-yl)acetate.
| Compound Name | ethyl 2-hydroxy-2-(5-hydroxy-2-oxo-1,3-benzoxathiol-6-yl)acetate |
|---|---|
| PubChem CID | 117428716 |
| Molecular Formula | C11H10O6S |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | ethyl 2-hydroxy-2-(5-hydroxy-2-oxo-1,3-benzoxathiol-6-yl)acetate |
| SMILES | CCOC(=O)C(O)c1cc2oc(=O)sc2cc1O |
| InChI | InChI=1S/C11H10O6S/c1-2-16-10(14)9(13)5-3-7-8(4-6(5)12)18-11(15)17-7/h3-4,9,12-13H,2H2,1H3 |
| InChIKey | VJGCMENDLOTBRX-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'} |
|---|