C12H16O6 — CID 117393736
ethyl 2-hydroxy-2-(4-hydroxy-2,5-dimethoxyphenyl)acetate (PubChem CID 117393736) has the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. Its IUPAC name is ethyl 2-hydroxy-2-(4-hydroxy-2,5-dimethoxyphenyl)acetate.
| Compound Name | ethyl 2-hydroxy-2-(4-hydroxy-2,5-dimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 117393736 |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | ethyl 2-hydroxy-2-(4-hydroxy-2,5-dimethoxyphenyl)acetate |
| SMILES | CCOC(=O)C(O)c1cc(OC)c(O)cc1OC |
| InChI | InChI=1S/C12H16O6/c1-4-18-12(15)11(14)7-5-10(17-3)8(13)6-9(7)16-2/h5-6,11,13-14H,4H2,1-3H3 |
| InChIKey | PGGCJCOWQBFBSW-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |