C10H15NO3 — CID 117287023
4-(1-aminoethyl)-2,5-dimethoxyphenol (PubChem CID 117287023) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 4-(1-aminoethyl)-2,5-dimethoxyphenol.
| Compound Name | 4-(1-aminoethyl)-2,5-dimethoxyphenol |
|---|---|
| PubChem CID | 117287023 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 4-(1-aminoethyl)-2,5-dimethoxyphenol |
| SMILES | COc1cc(C(C)N)c(OC)cc1O |
| InChI | InChI=1S/C10H15NO3/c1-6(11)7-4-10(14-3)8(12)5-9(7)13-2/h4-6,12H,11H2,1-3H3 |
| InChIKey | NYACZTADMOQHQC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |