C13H13NO5S — CID 117475906
5-(7-methoxy-2-oxo-1,3-benzoxathiol-5-yl)pyrrolidine-3-carboxylic acid (PubChem CID 117475906) has the molecular formula C13H13NO5S and a molecular weight of 295.32 g/mol. Its IUPAC name is 5-(7-methoxy-2-oxo-1,3-benzoxathiol-5-yl)pyrrolidine-3-carboxylic acid.
| Compound Name | 5-(7-methoxy-2-oxo-1,3-benzoxathiol-5-yl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 117475906 |
| Molecular Formula | C13H13NO5S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 5-(7-methoxy-2-oxo-1,3-benzoxathiol-5-yl)pyrrolidine-3-carboxylic acid |
| SMILES | COc1cc(C2CC(C(=O)O)CN2)cc2sc(=O)oc12 |
| InChI | InChI=1S/C13H13NO5S/c1-18-9-3-6(4-10-11(9)19-13(17)20-10)8-2-7(5-14-8)12(15)16/h3-4,7-8,14H,2,5H2,1H3,(H,15,16) |
| InChIKey | UNXHNPNGLLNCTF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_carbonate_B(3)', 'substructure': 'N/A'} |
|---|