C13H12O5S — CID 117449771
2-[1-(7-methoxy-2-oxo-1,3-benzoxathiol-5-yl)cyclopropyl]acetic acid (PubChem CID 117449771) has the molecular formula C13H12O5S and a molecular weight of 280.30 g/mol. Its IUPAC name is 2-[1-(7-methoxy-2-oxo-1,3-benzoxathiol-5-yl)cyclopropyl]acetic acid.
| Compound Name | 2-[1-(7-methoxy-2-oxo-1,3-benzoxathiol-5-yl)cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 117449771 |
| Molecular Formula | C13H12O5S |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 2-[1-(7-methoxy-2-oxo-1,3-benzoxathiol-5-yl)cyclopropyl]acetic acid |
| SMILES | COc1cc(C2(CC(=O)O)CC2)cc2sc(=O)oc12 |
| InChI | InChI=1S/C13H12O5S/c1-17-8-4-7(13(2-3-13)6-10(14)15)5-9-11(8)18-12(16)19-9/h4-5H,2-3,6H2,1H3,(H,14,15) |
| InChIKey | XGODOMDMZDMXHJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_carbonate_B(3)', 'substructure': 'N/A'} |
|---|