2-[1-(2,3,4-trimethoxyphenyl)cyclopropyl]acetic acid

C14H18O5 — CID 115003452

IUPAC2-[1-(2,3,4-trimethoxyphenyl)cyclopropyl]acetic acid
SMILESCOc1ccc(C2(CC(=O)O)CC2)c(OC)c1OC
InChIInChI=1S/C14H18O5/c1-17-10-5-4-9(12(18-2)13(10)19-3)14(6-7-14)8-11(15)16/h4-5H,6-8H2,1-3H3,(H,15,16)
InChIKeyFZIWXGQCRRCCOP-UHFFFAOYSA-N
MW266.29 g/mol
LogP2.22
Rot. Bonds6

About 2-[1-(2,3,4-trimethoxyphenyl)cyclopropyl]acetic acid

2-[1-(2,3,4-trimethoxyphenyl)cyclopropyl]acetic acid (PubChem CID 115003452) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is 2-[1-(2,3,4-trimethoxyphenyl)cyclopropyl]acetic acid.

Molecular Properties

Compound Name2-[1-(2,3,4-trimethoxyphenyl)cyclopropyl]acetic acid
PubChem CID115003452
Molecular FormulaC14H18O5
Molecular Weight266.29 g/mol
Exact Mass266.12
IUPAC Name2-[1-(2,3,4-trimethoxyphenyl)cyclopropyl]acetic acid
SMILESCOc1ccc(C2(CC(=O)O)CC2)c(OC)c1OC
InChIInChI=1S/C14H18O5/c1-17-10-5-4-9(12(18-2)13(10)19-3)14(6-7-14)8-11(15)16/h4-5H,6-8H2,1-3H3,(H,15,16)
InChIKeyFZIWXGQCRRCCOP-UHFFFAOYSA-N
XLogP2.22
TPSA64.99 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.29
LogP ≤ 52.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[1-(2,3,4-trimethoxyphenyl)cyclopropyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[1-(2,3,4-trimethoxyphenyl)cyclopropyl]acetic acid?
The IUPAC name of 2-[1-(2,3,4-trimethoxyphenyl)cyclopropyl]acetic acid (CID 115003452) is 2-[1-(2,3,4-trimethoxyphenyl)cyclopropyl]acetic acid.
What is the SMILES notation for 2-[1-(2,3,4-trimethoxyphenyl)cyclopropyl]acetic acid?
The canonical SMILES for 2-[1-(2,3,4-trimethoxyphenyl)cyclopropyl]acetic acid is COc1ccc(C2(CC(=O)O)CC2)c(OC)c1OC.
What is the InChIKey of 2-[1-(2,3,4-trimethoxyphenyl)cyclopropyl]acetic acid?
The InChIKey is FZIWXGQCRRCCOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O5/c1-17-10-5-4-9(12(18-2)13(10)19-3)14(6-7-14)8-11(15)16/h4-5H,6-8H2,1-3H3,(H,15,16).
What are the key properties of 2-[1-(2,3,4-trimethoxyphenyl)cyclopropyl]acetic acid?
2-[1-(2,3,4-trimethoxyphenyl)cyclopropyl]acetic acid has a molecular weight of 266.29 g/mol, XLogP of 2.22, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2,3,4-trimethoxyphenyl)cyclopropyl]acetic acid is sourced from PubChem (CID 115003452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).