2-[1-(5-ethyl-2,3-dimethoxyphenyl)cyclopropyl]acetic acid

C15H20O4 — CID 117415105

IUPAC2-[1-(5-ethyl-2,3-dimethoxyphenyl)cyclopropyl]acetic acid
SMILESCCc1cc(OC)c(OC)c(C2(CC(=O)O)CC2)c1
InChIInChI=1S/C15H20O4/c1-4-10-7-11(14(19-3)12(8-10)18-2)15(5-6-15)9-13(16)17/h7-8H,4-6,9H2,1-3H3,(H,16,17)
InChIKeyBXQKSXWVIZFSEZ-UHFFFAOYSA-N
MW264.32 g/mol
LogP2.77
Rot. Bonds6

About 2-[1-(5-ethyl-2,3-dimethoxyphenyl)cyclopropyl]acetic acid

2-[1-(5-ethyl-2,3-dimethoxyphenyl)cyclopropyl]acetic acid (PubChem CID 117415105) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is 2-[1-(5-ethyl-2,3-dimethoxyphenyl)cyclopropyl]acetic acid.

Molecular Properties

Compound Name2-[1-(5-ethyl-2,3-dimethoxyphenyl)cyclopropyl]acetic acid
PubChem CID117415105
Molecular FormulaC15H20O4
Molecular Weight264.32 g/mol
Exact Mass264.14
IUPAC Name2-[1-(5-ethyl-2,3-dimethoxyphenyl)cyclopropyl]acetic acid
SMILESCCc1cc(OC)c(OC)c(C2(CC(=O)O)CC2)c1
InChIInChI=1S/C15H20O4/c1-4-10-7-11(14(19-3)12(8-10)18-2)15(5-6-15)9-13(16)17/h7-8H,4-6,9H2,1-3H3,(H,16,17)
InChIKeyBXQKSXWVIZFSEZ-UHFFFAOYSA-N
XLogP2.77
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.32
LogP ≤ 52.77
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[1-(5-ethyl-2,3-dimethoxyphenyl)cyclopropyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[1-(5-ethyl-2,3-dimethoxyphenyl)cyclopropyl]acetic acid?
The IUPAC name of 2-[1-(5-ethyl-2,3-dimethoxyphenyl)cyclopropyl]acetic acid (CID 117415105) is 2-[1-(5-ethyl-2,3-dimethoxyphenyl)cyclopropyl]acetic acid.
What is the SMILES notation for 2-[1-(5-ethyl-2,3-dimethoxyphenyl)cyclopropyl]acetic acid?
The canonical SMILES for 2-[1-(5-ethyl-2,3-dimethoxyphenyl)cyclopropyl]acetic acid is CCc1cc(OC)c(OC)c(C2(CC(=O)O)CC2)c1.
What is the InChIKey of 2-[1-(5-ethyl-2,3-dimethoxyphenyl)cyclopropyl]acetic acid?
The InChIKey is BXQKSXWVIZFSEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O4/c1-4-10-7-11(14(19-3)12(8-10)18-2)15(5-6-15)9-13(16)17/h7-8H,4-6,9H2,1-3H3,(H,16,17).
What are the key properties of 2-[1-(5-ethyl-2,3-dimethoxyphenyl)cyclopropyl]acetic acid?
2-[1-(5-ethyl-2,3-dimethoxyphenyl)cyclopropyl]acetic acid has a molecular weight of 264.32 g/mol, XLogP of 2.77, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(5-ethyl-2,3-dimethoxyphenyl)cyclopropyl]acetic acid is sourced from PubChem (CID 117415105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).