C24H18O6S — CID 5134065
[7-(4-methoxyphenyl)-2-oxo-1,3-benzoxathiol-5-yl] 3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 5134065) has the molecular formula C24H18O6S and a molecular weight of 434.47 g/mol. Its IUPAC name is [7-(4-methoxyphenyl)-2-oxo-1,3-benzoxathiol-5-yl] 3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | [7-(4-methoxyphenyl)-2-oxo-1,3-benzoxathiol-5-yl] 3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 5134065 |
| Molecular Formula | C24H18O6S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | [7-(4-methoxyphenyl)-2-oxo-1,3-benzoxathiol-5-yl] 3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(C=CC(=O)Oc2cc(-c3ccc(OC)cc3)c3oc(=O)sc3c2)cc1 |
| InChI | InChI=1S/C24H18O6S/c1-27-17-8-3-15(4-9-17)5-12-22(25)29-19-13-20(16-6-10-18(28-2)11-7-16)23-21(14-19)31-24(26)30-23/h3-14H,1-2H3 |
| InChIKey | OGDFZHFRNILQKJ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|