C21H13ClO4S — CID 2023191
[7-(4-methylphenyl)-2-oxo-1,3-benzoxathiol-5-yl] 4-chlorobenzoate (PubChem CID 2023191) has the molecular formula C21H13ClO4S and a molecular weight of 396.85 g/mol. Its IUPAC name is [7-(4-methylphenyl)-2-oxo-1,3-benzoxathiol-5-yl] 4-chlorobenzoate.
| Compound Name | [7-(4-methylphenyl)-2-oxo-1,3-benzoxathiol-5-yl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 2023191 |
| Molecular Formula | C21H13ClO4S |
| Molecular Weight | 396.85 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | [7-(4-methylphenyl)-2-oxo-1,3-benzoxathiol-5-yl] 4-chlorobenzoate |
| SMILES | Cc1ccc(-c2cc(OC(=O)c3ccc(Cl)cc3)cc3sc(=O)oc23)cc1 |
| InChI | InChI=1S/C21H13ClO4S/c1-12-2-4-13(5-3-12)17-10-16(11-18-19(17)26-21(24)27-18)25-20(23)14-6-8-15(22)9-7-14/h2-11H,1H3 |
| InChIKey | JEKZPFZRROHXNV-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.85 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|