C21H13BrO3S2 — CID 4913226
[7-(4-bromophenyl)-2-sulfanylidene-1,3-benzoxathiol-5-yl] 4-methylbenzoate (PubChem CID 4913226) has the molecular formula C21H13BrO3S2 and a molecular weight of 457.37 g/mol. Its IUPAC name is [7-(4-bromophenyl)-2-sulfanylidene-1,3-benzoxathiol-5-yl] 4-methylbenzoate.
| Compound Name | [7-(4-bromophenyl)-2-sulfanylidene-1,3-benzoxathiol-5-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 4913226 |
| Molecular Formula | C21H13BrO3S2 |
| Molecular Weight | 457.37 g/mol |
| Exact Mass | 455.95 |
| IUPAC Name | [7-(4-bromophenyl)-2-sulfanylidene-1,3-benzoxathiol-5-yl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2cc(-c3ccc(Br)cc3)c3oc(=S)sc3c2)cc1 |
| InChI | InChI=1S/C21H13BrO3S2/c1-12-2-4-14(5-3-12)20(23)24-16-10-17(13-6-8-15(22)9-7-13)19-18(11-16)27-21(26)25-19/h2-11H,1H3 |
| InChIKey | QNBQDWVROKFIJF-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.37 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|