About [7-(4-bromophenyl)-2-sulfanylidene-1,3-benzoxathiol-5-yl] 4-methylbenzoate
[7-(4-bromophenyl)-2-sulfanylidene-1,3-benzoxathiol-5-yl] 4-methylbenzoate (PubChem CID 4913226) has the molecular formula C21H13BrO3S2
and a molecular weight of 457.37 g/mol. Its IUPAC name is [7-(4-bromophenyl)-2-sulfanylidene-1,3-benzoxathiol-5-yl] 4-methylbenzoate.
Molecular Properties
| Compound Name | [7-(4-bromophenyl)-2-sulfanylidene-1,3-benzoxathiol-5-yl] 4-methylbenzoate |
| PubChem CID | 4913226 |
| Molecular Formula | C21H13BrO3S2 |
| Molecular Weight | 457.37 g/mol |
| Exact Mass | 455.95 |
| IUPAC Name | [7-(4-bromophenyl)-2-sulfanylidene-1,3-benzoxathiol-5-yl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2cc(-c3ccc(Br)cc3)c3oc(=S)sc3c2)cc1 |
| InChI | InChI=1S/C21H13BrO3S2/c1-12-2-4-14(5-3-12)20(23)24-16-10-17(13-6-8-15(22)9-7-13)19-18(11-16)27-21(26)25-19/h2-11H,1H3 |
| InChIKey | QNBQDWVROKFIJF-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.37 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [7-(4-bromophenyl)-2-sulfanylidene-1,3-benzoxathiol-5-yl] 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-(4-bromophenyl)-2-sulfanylidene-1,3-benzoxathiol-5-yl] 4-methylbenzoate?
The IUPAC name of [7-(4-bromophenyl)-2-sulfanylidene-1,3-benzoxathiol-5-yl] 4-methylbenzoate (CID 4913226) is [7-(4-bromophenyl)-2-sulfanylidene-1,3-benzoxathiol-5-yl] 4-methylbenzoate.
What is the SMILES notation for [7-(4-bromophenyl)-2-sulfanylidene-1,3-benzoxathiol-5-yl] 4-methylbenzoate?
The canonical SMILES for [7-(4-bromophenyl)-2-sulfanylidene-1,3-benzoxathiol-5-yl] 4-methylbenzoate is Cc1ccc(C(=O)Oc2cc(-c3ccc(Br)cc3)c3oc(=S)sc3c2)cc1.
What is the InChIKey of [7-(4-bromophenyl)-2-sulfanylidene-1,3-benzoxathiol-5-yl] 4-methylbenzoate?
The InChIKey is QNBQDWVROKFIJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H13BrO3S2/c1-12-2-4-14(5-3-12)20(23)24-16-10-17(13-6-8-15(22)9-7-13)19-18(11-16)27-21(26)25-19/h2-11H,1H3.
What are the key properties of [7-(4-bromophenyl)-2-sulfanylidene-1,3-benzoxathiol-5-yl] 4-methylbenzoate?
[7-(4-bromophenyl)-2-sulfanylidene-1,3-benzoxathiol-5-yl] 4-methylbenzoate has a molecular weight of 457.37 g/mol, XLogP of 7.18, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [7-(4-bromophenyl)-2-sulfanylidene-1,3-benzoxathiol-5-yl] 4-methylbenzoate is sourced from PubChem (CID 4913226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).