C16H10O5 — CID 54004932
(1,3-dioxo-2-benzofuran-5-yl) 4-methylbenzoate (PubChem CID 54004932) has the molecular formula C16H10O5 and a molecular weight of 282.25 g/mol. Its IUPAC name is (1,3-dioxo-2-benzofuran-5-yl) 4-methylbenzoate.
| Compound Name | (1,3-dioxo-2-benzofuran-5-yl) 4-methylbenzoate |
|---|---|
| PubChem CID | 54004932 |
| Molecular Formula | C16H10O5 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | (1,3-dioxo-2-benzofuran-5-yl) 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc3c(c2)C(=O)OC3=O)cc1 |
| InChI | InChI=1S/C16H10O5/c1-9-2-4-10(5-3-9)14(17)20-11-6-7-12-13(8-11)16(19)21-15(12)18/h2-8H,1H3 |
| InChIKey | KOEQOMGUZFGDGO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|