C23H12O8 — CID 140945683
[4-(4-formylphenoxy)carbonylphenyl] 1,3-dioxo-2-benzofuran-5-carboxylate (PubChem CID 140945683) has the molecular formula C23H12O8 and a molecular weight of 416.34 g/mol. Its IUPAC name is [4-(4-formylphenoxy)carbonylphenyl] 1,3-dioxo-2-benzofuran-5-carboxylate.
| Compound Name | [4-(4-formylphenoxy)carbonylphenyl] 1,3-dioxo-2-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 140945683 |
| Molecular Formula | C23H12O8 |
| Molecular Weight | 416.34 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | [4-(4-formylphenoxy)carbonylphenyl] 1,3-dioxo-2-benzofuran-5-carboxylate |
| SMILES | O=Cc1ccc(OC(=O)c2ccc(OC(=O)c3ccc4c(c3)C(=O)OC4=O)cc2)cc1 |
| InChI | InChI=1S/C23H12O8/c24-12-13-1-6-16(7-2-13)29-20(25)14-3-8-17(9-4-14)30-21(26)15-5-10-18-19(11-15)23(28)31-22(18)27/h1-12H |
| InChIKey | UWTYLJZUPSTFBZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|