ethane;(4-hydroxyphenyl) 1,3-dioxo-2-benzofuran-5-carboxylate

C17H14O6 — CID 91132241

IUPACethane;(4-hydroxyphenyl) 1,3-dioxo-2-benzofuran-5-carboxylate
SMILESCC.O=C(Oc1ccc(O)cc1)c1ccc2c(c1)C(=O)OC2=O
InChIInChI=1S/C15H8O6.C2H6/c16-9-2-4-10(5-3-9)20-13(17)8-1-6-11-12(7-8)15(19)21-14(11)18;1-2/h1-7,16H;1-2H3
InChIKeyUOMUOEPHABQWLZ-UHFFFAOYSA-N
MW314.29 g/mol
LogP2.95
Rot. Bonds2

About ethane;(4-hydroxyphenyl) 1,3-dioxo-2-benzofuran-5-carboxylate

ethane;(4-hydroxyphenyl) 1,3-dioxo-2-benzofuran-5-carboxylate (PubChem CID 91132241) has the molecular formula C17H14O6 and a molecular weight of 314.29 g/mol. Its IUPAC name is ethane;(4-hydroxyphenyl) 1,3-dioxo-2-benzofuran-5-carboxylate.

Molecular Properties

Compound Nameethane;(4-hydroxyphenyl) 1,3-dioxo-2-benzofuran-5-carboxylate
PubChem CID91132241
Molecular FormulaC17H14O6
Molecular Weight314.29 g/mol
Exact Mass314.08
IUPAC Nameethane;(4-hydroxyphenyl) 1,3-dioxo-2-benzofuran-5-carboxylate
SMILESCC.O=C(Oc1ccc(O)cc1)c1ccc2c(c1)C(=O)OC2=O
InChIInChI=1S/C15H8O6.C2H6/c16-9-2-4-10(5-3-9)20-13(17)8-1-6-11-12(7-8)15(19)21-14(11)18;1-2/h1-7,16H;1-2H3
InChIKeyUOMUOEPHABQWLZ-UHFFFAOYSA-N
XLogP2.95
TPSA89.90 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds2
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500314.29
LogP ≤ 52.95
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze ethane;(4-hydroxyphenyl) 1,3-dioxo-2-benzofuran-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;(4-hydroxyphenyl) 1,3-dioxo-2-benzofuran-5-carboxylate?
The IUPAC name of ethane;(4-hydroxyphenyl) 1,3-dioxo-2-benzofuran-5-carboxylate (CID 91132241) is ethane;(4-hydroxyphenyl) 1,3-dioxo-2-benzofuran-5-carboxylate.
What is the SMILES notation for ethane;(4-hydroxyphenyl) 1,3-dioxo-2-benzofuran-5-carboxylate?
The canonical SMILES for ethane;(4-hydroxyphenyl) 1,3-dioxo-2-benzofuran-5-carboxylate is CC.O=C(Oc1ccc(O)cc1)c1ccc2c(c1)C(=O)OC2=O.
What is the InChIKey of ethane;(4-hydroxyphenyl) 1,3-dioxo-2-benzofuran-5-carboxylate?
The InChIKey is UOMUOEPHABQWLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8O6.C2H6/c16-9-2-4-10(5-3-9)20-13(17)8-1-6-11-12(7-8)15(19)21-14(11)18;1-2/h1-7,16H;1-2H3.
What are the key properties of ethane;(4-hydroxyphenyl) 1,3-dioxo-2-benzofuran-5-carboxylate?
ethane;(4-hydroxyphenyl) 1,3-dioxo-2-benzofuran-5-carboxylate has a molecular weight of 314.29 g/mol, XLogP of 2.95, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(4-hydroxyphenyl) 1,3-dioxo-2-benzofuran-5-carboxylate is sourced from PubChem (CID 91132241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).