C17H14O6 — CID 91132241
ethane;(4-hydroxyphenyl) 1,3-dioxo-2-benzofuran-5-carboxylate (PubChem CID 91132241) has the molecular formula C17H14O6 and a molecular weight of 314.29 g/mol. Its IUPAC name is ethane;(4-hydroxyphenyl) 1,3-dioxo-2-benzofuran-5-carboxylate.
| Compound Name | ethane;(4-hydroxyphenyl) 1,3-dioxo-2-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 91132241 |
| Molecular Formula | C17H14O6 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | ethane;(4-hydroxyphenyl) 1,3-dioxo-2-benzofuran-5-carboxylate |
| SMILES | CC.O=C(Oc1ccc(O)cc1)c1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C15H8O6.C2H6/c16-9-2-4-10(5-3-9)20-13(17)8-1-6-11-12(7-8)15(19)21-14(11)18;1-2/h1-7,16H;1-2H3 |
| InChIKey | UOMUOEPHABQWLZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|