C22H14O8 — CID 87610326
1,3-dioxo-2-benzofuran-5-carboxylic acid;phenyl 2-hydroxybenzoate (PubChem CID 87610326) has the molecular formula C22H14O8 and a molecular weight of 406.35 g/mol. Its IUPAC name is 1,3-dioxo-2-benzofuran-5-carboxylic acid;phenyl 2-hydroxybenzoate.
| Compound Name | 1,3-dioxo-2-benzofuran-5-carboxylic acid;phenyl 2-hydroxybenzoate |
|---|---|
| PubChem CID | 87610326 |
| Molecular Formula | C22H14O8 |
| Molecular Weight | 406.35 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 1,3-dioxo-2-benzofuran-5-carboxylic acid;phenyl 2-hydroxybenzoate |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)OC2=O.O=C(Oc1ccccc1)c1ccccc1O |
| InChI | InChI=1S/C13H10O3.C9H4O5/c14-12-9-5-4-8-11(12)13(15)16-10-6-2-1-3-7-10;10-7(11)4-1-2-5-6(3-4)9(13)14-8(5)12/h1-9,14H;1-3H,(H,10,11) |
| InChIKey | QPIKCUSLUKWUEA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|