About 2-hydroxybenzoic acid;phenyl 2-hydroxybenzoate;phenylmercury
2-hydroxybenzoic acid;phenyl 2-hydroxybenzoate;phenylmercury (PubChem CID 174770539) has the molecular formula C26H21HgO6
and a molecular weight of 630.04 g/mol. Its IUPAC name is 2-hydroxybenzoic acid;phenyl 2-hydroxybenzoate;phenylmercury.
Molecular Properties
| Compound Name | 2-hydroxybenzoic acid;phenyl 2-hydroxybenzoate;phenylmercury |
| PubChem CID | 174770539 |
| Molecular Formula | C26H21HgO6 |
| Molecular Weight | 630.04 g/mol |
| Exact Mass | 631.10 |
| IUPAC Name | 2-hydroxybenzoic acid;phenyl 2-hydroxybenzoate;phenylmercury |
| SMILES | O=C(O)c1ccccc1O.O=C(Oc1ccccc1)c1ccccc1O.[Hg]c1ccccc1 |
| InChI | InChI=1S/C13H10O3.C7H6O3.C6H5.Hg/c14-12-9-5-4-8-11(12)13(15)16-10-6-2-1-3-7-10;8-6-4-2-1-3-5(6)7(9)10;1-2-4-6-5-3-1;/h1-9,14H;1-4,8H,(H,9,10);1-5H; |
| InChIKey | NURNXYITVRVKQZ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 630.04 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxybenzoic acid;phenyl 2-hydroxybenzoate;phenylmercury with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybenzoic acid;phenyl 2-hydroxybenzoate;phenylmercury?
The IUPAC name of 2-hydroxybenzoic acid;phenyl 2-hydroxybenzoate;phenylmercury (CID 174770539) is 2-hydroxybenzoic acid;phenyl 2-hydroxybenzoate;phenylmercury.
What is the SMILES notation for 2-hydroxybenzoic acid;phenyl 2-hydroxybenzoate;phenylmercury?
The canonical SMILES for 2-hydroxybenzoic acid;phenyl 2-hydroxybenzoate;phenylmercury is O=C(O)c1ccccc1O.O=C(Oc1ccccc1)c1ccccc1O.[Hg]c1ccccc1.
What is the InChIKey of 2-hydroxybenzoic acid;phenyl 2-hydroxybenzoate;phenylmercury?
The InChIKey is NURNXYITVRVKQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O3.C7H6O3.C6H5.Hg/c14-12-9-5-4-8-11(12)13(15)16-10-6-2-1-3-7-10;8-6-4-2-1-3-5(6)7(9)10;1-2-4-6-5-3-1;/h1-9,14H;1-4,8H,(H,9,10);1-5H;.
What are the key properties of 2-hydroxybenzoic acid;phenyl 2-hydroxybenzoate;phenylmercury?
2-hydroxybenzoic acid;phenyl 2-hydroxybenzoate;phenylmercury has a molecular weight of 630.04 g/mol, XLogP of 4.56, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybenzoic acid;phenyl 2-hydroxybenzoate;phenylmercury is sourced from PubChem (CID 174770539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).