carbonic acid;methyl 2-hydroxybenzoate;phenyl hydrogen carbonate

C16H16O9 — CID 159882393

IUPACcarbonic acid;methyl 2-hydroxybenzoate;phenyl hydrogen carbonate
SMILESCOC(=O)c1ccccc1O.O=C(O)O.O=C(O)Oc1ccccc1
InChIInChI=1S/C8H8O3.C7H6O3.CH2O3/c1-11-8(10)6-4-2-3-5-7(6)9;8-7(9)10-6-4-2-1-3-5-6;2-1(3)4/h2-5,9H,1H3;1-5H,(H,8,9);(H2,2,3,4)
InChIKeyNTRMBPFMCJVKOF-UHFFFAOYSA-N
MW352.30 g/mol
LogP3.14
Rot. Bonds2

About carbonic acid;methyl 2-hydroxybenzoate;phenyl hydrogen carbonate

carbonic acid;methyl 2-hydroxybenzoate;phenyl hydrogen carbonate (PubChem CID 159882393) has the molecular formula C16H16O9 and a molecular weight of 352.30 g/mol. Its IUPAC name is carbonic acid;methyl 2-hydroxybenzoate;phenyl hydrogen carbonate.

Molecular Properties

Compound Namecarbonic acid;methyl 2-hydroxybenzoate;phenyl hydrogen carbonate
PubChem CID159882393
Molecular FormulaC16H16O9
Molecular Weight352.30 g/mol
Exact Mass352.08
IUPAC Namecarbonic acid;methyl 2-hydroxybenzoate;phenyl hydrogen carbonate
SMILESCOC(=O)c1ccccc1O.O=C(O)O.O=C(O)Oc1ccccc1
InChIInChI=1S/C8H8O3.C7H6O3.CH2O3/c1-11-8(10)6-4-2-3-5-7(6)9;8-7(9)10-6-4-2-1-3-5-6;2-1(3)4/h2-5,9H,1H3;1-5H,(H,8,9);(H2,2,3,4)
InChIKeyNTRMBPFMCJVKOF-UHFFFAOYSA-N
XLogP3.14
TPSA150.59 Ų
H-Bond Donors4
H-Bond Acceptors6
Rotatable Bonds2
Heavy Atoms25
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500352.30
LogP ≤ 53.14
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}

Analyze carbonic acid;methyl 2-hydroxybenzoate;phenyl hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbonic acid;methyl 2-hydroxybenzoate;phenyl hydrogen carbonate?
The IUPAC name of carbonic acid;methyl 2-hydroxybenzoate;phenyl hydrogen carbonate (CID 159882393) is carbonic acid;methyl 2-hydroxybenzoate;phenyl hydrogen carbonate.
What is the SMILES notation for carbonic acid;methyl 2-hydroxybenzoate;phenyl hydrogen carbonate?
The canonical SMILES for carbonic acid;methyl 2-hydroxybenzoate;phenyl hydrogen carbonate is COC(=O)c1ccccc1O.O=C(O)O.O=C(O)Oc1ccccc1.
What is the InChIKey of carbonic acid;methyl 2-hydroxybenzoate;phenyl hydrogen carbonate?
The InChIKey is NTRMBPFMCJVKOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3.C7H6O3.CH2O3/c1-11-8(10)6-4-2-3-5-7(6)9;8-7(9)10-6-4-2-1-3-5-6;2-1(3)4/h2-5,9H,1H3;1-5H,(H,8,9);(H2,2,3,4).
What are the key properties of carbonic acid;methyl 2-hydroxybenzoate;phenyl hydrogen carbonate?
carbonic acid;methyl 2-hydroxybenzoate;phenyl hydrogen carbonate has a molecular weight of 352.30 g/mol, XLogP of 3.14, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;methyl 2-hydroxybenzoate;phenyl hydrogen carbonate is sourced from PubChem (CID 159882393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).