About lithium;hydride;methyl 2-hydroxybenzoate
lithium;hydride;methyl 2-hydroxybenzoate (PubChem CID 173284844) has the molecular formula C8H9LiO3
and a molecular weight of 160.10 g/mol. Its IUPAC name is lithium;hydride;methyl 2-hydroxybenzoate.
Molecular Properties
| Compound Name | lithium;hydride;methyl 2-hydroxybenzoate |
| PubChem CID | 173284844 |
| Molecular Formula | C8H9LiO3 |
| Molecular Weight | 160.10 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | lithium;hydride;methyl 2-hydroxybenzoate |
| SMILES | COC(=O)c1ccccc1O.[H-].[Li+] |
| InChI | InChI=1S/C8H8O3.Li.H/c1-11-8(10)6-4-2-3-5-7(6)9;;/h2-5,9H,1H3;;/q;+1;-1 |
| InChIKey | VQKMMEOSJWLYMJ-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.10 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze lithium;hydride;methyl 2-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hydride;methyl 2-hydroxybenzoate?
The IUPAC name of lithium;hydride;methyl 2-hydroxybenzoate (CID 173284844) is lithium;hydride;methyl 2-hydroxybenzoate.
What is the SMILES notation for lithium;hydride;methyl 2-hydroxybenzoate?
The canonical SMILES for lithium;hydride;methyl 2-hydroxybenzoate is COC(=O)c1ccccc1O.[H-].[Li+].
What is the InChIKey of lithium;hydride;methyl 2-hydroxybenzoate?
The InChIKey is VQKMMEOSJWLYMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3.Li.H/c1-11-8(10)6-4-2-3-5-7(6)9;;/h2-5,9H,1H3;;/q;+1;-1.
What are the key properties of lithium;hydride;methyl 2-hydroxybenzoate?
lithium;hydride;methyl 2-hydroxybenzoate has a molecular weight of 160.10 g/mol, XLogP of -1.70, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hydride;methyl 2-hydroxybenzoate is sourced from PubChem (CID 173284844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).