About strontium;acetyl 2-hydroxybenzoate;hydride
strontium;acetyl 2-hydroxybenzoate;hydride (PubChem CID 172999846) has the molecular formula C9H10O4Sr
and a molecular weight of 269.79 g/mol. Its IUPAC name is strontium;acetyl 2-hydroxybenzoate;hydride.
Molecular Properties
| Compound Name | strontium;acetyl 2-hydroxybenzoate;hydride |
| PubChem CID | 172999846 |
| Molecular Formula | C9H10O4Sr |
| Molecular Weight | 269.79 g/mol |
| Exact Mass | 269.96 |
| IUPAC Name | strontium;acetyl 2-hydroxybenzoate;hydride |
| SMILES | CC(=O)OC(=O)c1ccccc1O.[H-].[H-].[Sr+2] |
| InChI | InChI=1S/C9H8O4.Sr.2H/c1-6(10)13-9(12)7-4-2-3-5-8(7)11;;;/h2-5,11H,1H3;;;/q;+2;2*-1 |
| InChIKey | MECBIEJZCUXGFQ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.79 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze strontium;acetyl 2-hydroxybenzoate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of strontium;acetyl 2-hydroxybenzoate;hydride?
The IUPAC name of strontium;acetyl 2-hydroxybenzoate;hydride (CID 172999846) is strontium;acetyl 2-hydroxybenzoate;hydride.
What is the SMILES notation for strontium;acetyl 2-hydroxybenzoate;hydride?
The canonical SMILES for strontium;acetyl 2-hydroxybenzoate;hydride is CC(=O)OC(=O)c1ccccc1O.[H-].[H-].[Sr+2].
What is the InChIKey of strontium;acetyl 2-hydroxybenzoate;hydride?
The InChIKey is MECBIEJZCUXGFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O4.Sr.2H/c1-6(10)13-9(12)7-4-2-3-5-8(7)11;;;/h2-5,11H,1H3;;;/q;+2;2*-1.
What are the key properties of strontium;acetyl 2-hydroxybenzoate;hydride?
strontium;acetyl 2-hydroxybenzoate;hydride has a molecular weight of 269.79 g/mol, XLogP of 0.94, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for strontium;acetyl 2-hydroxybenzoate;hydride is sourced from PubChem (CID 172999846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).