About bis(2-hydroxybenzoyl) pentanedioate
bis(2-hydroxybenzoyl) pentanedioate (PubChem CID 57233739) has the molecular formula C19H16O8
and a molecular weight of 372.33 g/mol. Its IUPAC name is bis(2-hydroxybenzoyl) pentanedioate.
Molecular Properties
| Compound Name | bis(2-hydroxybenzoyl) pentanedioate |
| PubChem CID | 57233739 |
| Molecular Formula | C19H16O8 |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | bis(2-hydroxybenzoyl) pentanedioate |
| SMILES | O=C(CCCC(=O)OC(=O)c1ccccc1O)OC(=O)c1ccccc1O |
| InChI | InChI=1S/C19H16O8/c20-14-8-3-1-6-12(14)18(24)26-16(22)10-5-11-17(23)27-19(25)13-7-2-4-9-15(13)21/h1-4,6-9,20-21H,5,10-11H2 |
| InChIKey | MPWHJOOJPNSRCO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze bis(2-hydroxybenzoyl) pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-hydroxybenzoyl) pentanedioate?
The IUPAC name of bis(2-hydroxybenzoyl) pentanedioate (CID 57233739) is bis(2-hydroxybenzoyl) pentanedioate.
What is the SMILES notation for bis(2-hydroxybenzoyl) pentanedioate?
The canonical SMILES for bis(2-hydroxybenzoyl) pentanedioate is O=C(CCCC(=O)OC(=O)c1ccccc1O)OC(=O)c1ccccc1O.
What is the InChIKey of bis(2-hydroxybenzoyl) pentanedioate?
The InChIKey is MPWHJOOJPNSRCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16O8/c20-14-8-3-1-6-12(14)18(24)26-16(22)10-5-11-17(23)27-19(25)13-7-2-4-9-15(13)21/h1-4,6-9,20-21H,5,10-11H2.
What are the key properties of bis(2-hydroxybenzoyl) pentanedioate?
bis(2-hydroxybenzoyl) pentanedioate has a molecular weight of 372.33 g/mol, XLogP of 2.34, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-hydroxybenzoyl) pentanedioate is sourced from PubChem (CID 57233739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).