About butyl 2-hydroxybenzoate;butyl pentanoate
butyl 2-hydroxybenzoate;butyl pentanoate (PubChem CID 174922540) has the molecular formula C20H32O5
and a molecular weight of 352.47 g/mol. Its IUPAC name is butyl 2-hydroxybenzoate;butyl pentanoate.
Molecular Properties
| Compound Name | butyl 2-hydroxybenzoate;butyl pentanoate |
| PubChem CID | 174922540 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | butyl 2-hydroxybenzoate;butyl pentanoate |
| SMILES | CCCCOC(=O)CCCC.CCCCOC(=O)c1ccccc1O |
| InChI | InChI=1S/C11H14O3.C9H18O2/c1-2-3-8-14-11(13)9-6-4-5-7-10(9)12;1-3-5-7-9(10)11-8-6-4-2/h4-7,12H,2-3,8H2,1H3;3-8H2,1-2H3 |
| InChIKey | QVQQQAANMIJLSF-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-hydroxybenzoate;butyl pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-hydroxybenzoate;butyl pentanoate?
The IUPAC name of butyl 2-hydroxybenzoate;butyl pentanoate (CID 174922540) is butyl 2-hydroxybenzoate;butyl pentanoate.
What is the SMILES notation for butyl 2-hydroxybenzoate;butyl pentanoate?
The canonical SMILES for butyl 2-hydroxybenzoate;butyl pentanoate is CCCCOC(=O)CCCC.CCCCOC(=O)c1ccccc1O.
What is the InChIKey of butyl 2-hydroxybenzoate;butyl pentanoate?
The InChIKey is QVQQQAANMIJLSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3.C9H18O2/c1-2-3-8-14-11(13)9-6-4-5-7-10(9)12;1-3-5-7-9(10)11-8-6-4-2/h4-7,12H,2-3,8H2,1H3;3-8H2,1-2H3.
What are the key properties of butyl 2-hydroxybenzoate;butyl pentanoate?
butyl 2-hydroxybenzoate;butyl pentanoate has a molecular weight of 352.47 g/mol, XLogP of 4.87, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-hydroxybenzoate;butyl pentanoate is sourced from PubChem (CID 174922540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).