C28H42O8 — CID 175264378
bis(6-butoxy-6-oxohexyl) benzene-1,2-dicarboxylate (PubChem CID 175264378) has the molecular formula C28H42O8 and a molecular weight of 506.64 g/mol. Its IUPAC name is bis(6-butoxy-6-oxohexyl) benzene-1,2-dicarboxylate.
| Compound Name | bis(6-butoxy-6-oxohexyl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 175264378 |
| Molecular Formula | C28H42O8 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | bis(6-butoxy-6-oxohexyl) benzene-1,2-dicarboxylate |
| SMILES | CCCCOC(=O)CCCCCOC(=O)c1ccccc1C(=O)OCCCCCC(=O)OCCCC |
| InChI | InChI=1S/C28H42O8/c1-3-5-19-33-25(29)17-9-7-13-21-35-27(31)23-15-11-12-16-24(23)28(32)36-22-14-8-10-18-26(30)34-20-6-4-2/h11-12,15-16H,3-10,13-14,17-22H2,1-2H3 |
| InChIKey | SQLTWZNKWUZSKB-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|