About sodium;hydride;3-oxobutanoyl 2-hydroxybenzoate
sodium;hydride;3-oxobutanoyl 2-hydroxybenzoate (PubChem CID 174865772) has the molecular formula C11H11NaO5
and a molecular weight of 246.19 g/mol. Its IUPAC name is sodium;hydride;3-oxobutanoyl 2-hydroxybenzoate.
Molecular Properties
| Compound Name | sodium;hydride;3-oxobutanoyl 2-hydroxybenzoate |
| PubChem CID | 174865772 |
| Molecular Formula | C11H11NaO5 |
| Molecular Weight | 246.19 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | sodium;hydride;3-oxobutanoyl 2-hydroxybenzoate |
| SMILES | CC(=O)CC(=O)OC(=O)c1ccccc1O.[H-].[Na+] |
| InChI | InChI=1S/C11H10O5.Na.H/c1-7(12)6-10(14)16-11(15)8-4-2-3-5-9(8)13;;/h2-5,13H,6H2,1H3;;/q;+1;-1 |
| InChIKey | HWCNSRJRCVXBDN-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.19 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;3-oxobutanoyl 2-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;3-oxobutanoyl 2-hydroxybenzoate?
The IUPAC name of sodium;hydride;3-oxobutanoyl 2-hydroxybenzoate (CID 174865772) is sodium;hydride;3-oxobutanoyl 2-hydroxybenzoate.
What is the SMILES notation for sodium;hydride;3-oxobutanoyl 2-hydroxybenzoate?
The canonical SMILES for sodium;hydride;3-oxobutanoyl 2-hydroxybenzoate is CC(=O)CC(=O)OC(=O)c1ccccc1O.[H-].[Na+].
What is the InChIKey of sodium;hydride;3-oxobutanoyl 2-hydroxybenzoate?
The InChIKey is HWCNSRJRCVXBDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O5.Na.H/c1-7(12)6-10(14)16-11(15)8-4-2-3-5-9(8)13;;/h2-5,13H,6H2,1H3;;/q;+1;-1.
What are the key properties of sodium;hydride;3-oxobutanoyl 2-hydroxybenzoate?
sodium;hydride;3-oxobutanoyl 2-hydroxybenzoate has a molecular weight of 246.19 g/mol, XLogP of -1.83, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;3-oxobutanoyl 2-hydroxybenzoate is sourced from PubChem (CID 174865772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).