About 3-oxobutanoyl 2-chlorobenzoate
3-oxobutanoyl 2-chlorobenzoate (PubChem CID 175590196) has the molecular formula C11H9ClO4
and a molecular weight of 240.64 g/mol. Its IUPAC name is 3-oxobutanoyl 2-chlorobenzoate.
Molecular Properties
| Compound Name | 3-oxobutanoyl 2-chlorobenzoate |
| PubChem CID | 175590196 |
| Molecular Formula | C11H9ClO4 |
| Molecular Weight | 240.64 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | 3-oxobutanoyl 2-chlorobenzoate |
| SMILES | CC(=O)CC(=O)OC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C11H9ClO4/c1-7(13)6-10(14)16-11(15)8-4-2-3-5-9(8)12/h2-5H,6H2,1H3 |
| InChIKey | YKESVAOIMOOHEP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.64 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-oxobutanoyl 2-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxobutanoyl 2-chlorobenzoate?
The IUPAC name of 3-oxobutanoyl 2-chlorobenzoate (CID 175590196) is 3-oxobutanoyl 2-chlorobenzoate.
What is the SMILES notation for 3-oxobutanoyl 2-chlorobenzoate?
The canonical SMILES for 3-oxobutanoyl 2-chlorobenzoate is CC(=O)CC(=O)OC(=O)c1ccccc1Cl.
What is the InChIKey of 3-oxobutanoyl 2-chlorobenzoate?
The InChIKey is YKESVAOIMOOHEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClO4/c1-7(13)6-10(14)16-11(15)8-4-2-3-5-9(8)12/h2-5H,6H2,1H3.
What are the key properties of 3-oxobutanoyl 2-chlorobenzoate?
3-oxobutanoyl 2-chlorobenzoate has a molecular weight of 240.64 g/mol, XLogP of 2.00, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxobutanoyl 2-chlorobenzoate is sourced from PubChem (CID 175590196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).