C28H16Cl4O4 — CID 11284367
[(Z)-2-(2-chlorobenzoyl)oxy-1,2-bis(2-chlorophenyl)ethenyl] 2-chlorobenzoate (PubChem CID 11284367) has the molecular formula C28H16Cl4O4 and a molecular weight of 558.24 g/mol. Its IUPAC name is [(Z)-2-(2-chlorobenzoyl)oxy-1,2-bis(2-chlorophenyl)ethenyl] 2-chlorobenzoate.
| Compound Name | [(Z)-2-(2-chlorobenzoyl)oxy-1,2-bis(2-chlorophenyl)ethenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 11284367 |
| Molecular Formula | C28H16Cl4O4 |
| Molecular Weight | 558.24 g/mol |
| Exact Mass | 555.98 |
| IUPAC Name | [(Z)-2-(2-chlorobenzoyl)oxy-1,2-bis(2-chlorophenyl)ethenyl] 2-chlorobenzoate |
| SMILES | O=C(O/C(=C(\OC(=O)c1ccccc1Cl)c1ccccc1Cl)c1ccccc1Cl)c1ccccc1Cl |
| InChI | InChI=1S/C28H16Cl4O4/c29-21-13-5-1-9-17(21)25(35-27(33)19-11-3-7-15-23(19)31)26(18-10-2-6-14-22(18)30)36-28(34)20-12-4-8-16-24(20)32/h1-16H/b26-25- |
| InChIKey | ANUHPZSCIPOHSF-QPLCGJKRSA-N |
| XLogP | 8.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.24 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|