C24H14Cl2O6 — CID 140844723
[1,2-bis(2-chlorophenyl)-2-(furan-2-carbonyloxy)ethenyl] furan-2-carboxylate (PubChem CID 140844723) has the molecular formula C24H14Cl2O6 and a molecular weight of 469.28 g/mol. Its IUPAC name is [1,2-bis(2-chlorophenyl)-2-(furan-2-carbonyloxy)ethenyl] furan-2-carboxylate.
| Compound Name | [1,2-bis(2-chlorophenyl)-2-(furan-2-carbonyloxy)ethenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 140844723 |
| Molecular Formula | C24H14Cl2O6 |
| Molecular Weight | 469.28 g/mol |
| Exact Mass | 468.02 |
| IUPAC Name | [1,2-bis(2-chlorophenyl)-2-(furan-2-carbonyloxy)ethenyl] furan-2-carboxylate |
| SMILES | O=C(OC(=C(OC(=O)c1ccco1)c1ccccc1Cl)c1ccccc1Cl)c1ccco1 |
| InChI | InChI=1S/C24H14Cl2O6/c25-17-9-3-1-7-15(17)21(31-23(27)19-11-5-13-29-19)22(16-8-2-4-10-18(16)26)32-24(28)20-12-6-14-30-20/h1-14H |
| InChIKey | REYMYIZYNDMZGF-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 78.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.28 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|