About 4-oxopentyl 2-chlorobenzoate
4-oxopentyl 2-chlorobenzoate (PubChem CID 78846434) has the molecular formula C12H13ClO3
and a molecular weight of 240.69 g/mol. Its IUPAC name is 4-oxopentyl 2-chlorobenzoate.
Molecular Properties
| Compound Name | 4-oxopentyl 2-chlorobenzoate |
| PubChem CID | 78846434 |
| Molecular Formula | C12H13ClO3 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 4-oxopentyl 2-chlorobenzoate |
| SMILES | CC(=O)CCCOC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C12H13ClO3/c1-9(14)5-4-8-16-12(15)10-6-2-3-7-11(10)13/h2-3,6-7H,4-5,8H2,1H3 |
| InChIKey | WGSSZFJCURFXER-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-oxopentyl 2-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxopentyl 2-chlorobenzoate?
The IUPAC name of 4-oxopentyl 2-chlorobenzoate (CID 78846434) is 4-oxopentyl 2-chlorobenzoate.
What is the SMILES notation for 4-oxopentyl 2-chlorobenzoate?
The canonical SMILES for 4-oxopentyl 2-chlorobenzoate is CC(=O)CCCOC(=O)c1ccccc1Cl.
What is the InChIKey of 4-oxopentyl 2-chlorobenzoate?
The InChIKey is WGSSZFJCURFXER-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClO3/c1-9(14)5-4-8-16-12(15)10-6-2-3-7-11(10)13/h2-3,6-7H,4-5,8H2,1H3.
What are the key properties of 4-oxopentyl 2-chlorobenzoate?
4-oxopentyl 2-chlorobenzoate has a molecular weight of 240.69 g/mol, XLogP of 2.87, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxopentyl 2-chlorobenzoate is sourced from PubChem (CID 78846434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).