About 4-oxopentyl 2-methylbenzoate
4-oxopentyl 2-methylbenzoate (PubChem CID 78846435) has the molecular formula C13H16O3
and a molecular weight of 220.27 g/mol. Its IUPAC name is 4-oxopentyl 2-methylbenzoate.
Molecular Properties
| Compound Name | 4-oxopentyl 2-methylbenzoate |
| PubChem CID | 78846435 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 4-oxopentyl 2-methylbenzoate |
| SMILES | CC(=O)CCCOC(=O)c1ccccc1C |
| InChI | InChI=1S/C13H16O3/c1-10-6-3-4-8-12(10)13(15)16-9-5-7-11(2)14/h3-4,6,8H,5,7,9H2,1-2H3 |
| InChIKey | RMZHOVCVEQVZJY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-oxopentyl 2-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxopentyl 2-methylbenzoate?
The IUPAC name of 4-oxopentyl 2-methylbenzoate (CID 78846435) is 4-oxopentyl 2-methylbenzoate.
What is the SMILES notation for 4-oxopentyl 2-methylbenzoate?
The canonical SMILES for 4-oxopentyl 2-methylbenzoate is CC(=O)CCCOC(=O)c1ccccc1C.
What is the InChIKey of 4-oxopentyl 2-methylbenzoate?
The InChIKey is RMZHOVCVEQVZJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O3/c1-10-6-3-4-8-12(10)13(15)16-9-5-7-11(2)14/h3-4,6,8H,5,7,9H2,1-2H3.
What are the key properties of 4-oxopentyl 2-methylbenzoate?
4-oxopentyl 2-methylbenzoate has a molecular weight of 220.27 g/mol, XLogP of 2.52, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxopentyl 2-methylbenzoate is sourced from PubChem (CID 78846435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).